C24H27F3N6O — CID 156790876
N-[(1E)-1-(aminomethylideneamino)-1-pyrimidin-2-yliminopropan-2-yl]-N,3-bis(cyclopropylmethyl)-5-(trifluoromethyl)benzamide (PubChem CID 156790876) has the molecular formula C24H27F3N6O and a molecular weight of 472.52 g/mol. Its IUPAC name is N-[(1E)-1-(aminomethylideneamino)-1-pyrimidin-2-yliminopropan-2-yl]-N,3-bis(cyclopropylmethyl)-5-(trifluoromethyl)benzamide.
| Compound Name | N-[(1E)-1-(aminomethylideneamino)-1-pyrimidin-2-yliminopropan-2-yl]-N,3-bis(cyclopropylmethyl)-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 156790876 |
| Molecular Formula | C24H27F3N6O |
| Molecular Weight | 472.52 g/mol |
| Exact Mass | 472.22 |
| IUPAC Name | N-[(1E)-1-(aminomethylideneamino)-1-pyrimidin-2-yliminopropan-2-yl]-N,3-bis(cyclopropylmethyl)-5-(trifluoromethyl)benzamide |
| SMILES | CC(C(/N=C/N)=N\c1ncccn1)N(CC1CC1)C(=O)c1cc(CC2CC2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H27F3N6O/c1-15(21(31-14-28)32-23-29-7-2-8-30-23)33(13-17-5-6-17)22(34)19-10-18(9-16-3-4-16)11-20(12-19)24(25,26)27/h2,7-8,10-12,14-17H,3-6,9,13H2,1H3,(H2,28,29,30,31,32) |
| InChIKey | IUTMFGLDANNZTJ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 96.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.52 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|