C20H17ClF3N5O2 — CID 166473566
3-chloro-N-[1-[2-(C-methyl-N-phenoxycarbonimidoyl)-1,2,4-triazol-3-yl]ethyl]-5-(trifluoromethyl)benzamide (PubChem CID 166473566) has the molecular formula C20H17ClF3N5O2 and a molecular weight of 451.84 g/mol. Its IUPAC name is 3-chloro-N-[1-[2-(C-methyl-N-phenoxycarbonimidoyl)-1,2,4-triazol-3-yl]ethyl]-5-(trifluoromethyl)benzamide.
| Compound Name | 3-chloro-N-[1-[2-(C-methyl-N-phenoxycarbonimidoyl)-1,2,4-triazol-3-yl]ethyl]-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 166473566 |
| Molecular Formula | C20H17ClF3N5O2 |
| Molecular Weight | 451.84 g/mol |
| Exact Mass | 451.10 |
| IUPAC Name | 3-chloro-N-[1-[2-(C-methyl-N-phenoxycarbonimidoyl)-1,2,4-triazol-3-yl]ethyl]-5-(trifluoromethyl)benzamide |
| SMILES | CC(=NOc1ccccc1)n1ncnc1C(C)NC(=O)c1cc(Cl)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H17ClF3N5O2/c1-12(27-19(30)14-8-15(20(22,23)24)10-16(21)9-14)18-25-11-26-29(18)13(2)28-31-17-6-4-3-5-7-17/h3-12H,1-2H3,(H,27,30) |
| InChIKey | MTMMESSXDDEOQC-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.84 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|