C16H17ClF3N5O2 — CID 166473563
3-chloro-N-[1-[2-(N-ethoxy-C-methylcarbonimidoyl)-1,2,4-triazol-3-yl]ethyl]-5-(trifluoromethyl)benzamide (PubChem CID 166473563) has the molecular formula C16H17ClF3N5O2 and a molecular weight of 403.79 g/mol. Its IUPAC name is 3-chloro-N-[1-[2-(N-ethoxy-C-methylcarbonimidoyl)-1,2,4-triazol-3-yl]ethyl]-5-(trifluoromethyl)benzamide.
| Compound Name | 3-chloro-N-[1-[2-(N-ethoxy-C-methylcarbonimidoyl)-1,2,4-triazol-3-yl]ethyl]-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 166473563 |
| Molecular Formula | C16H17ClF3N5O2 |
| Molecular Weight | 403.79 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | 3-chloro-N-[1-[2-(N-ethoxy-C-methylcarbonimidoyl)-1,2,4-triazol-3-yl]ethyl]-5-(trifluoromethyl)benzamide |
| SMILES | CCON=C(C)n1ncnc1C(C)NC(=O)c1cc(Cl)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H17ClF3N5O2/c1-4-27-24-10(3)25-14(21-8-22-25)9(2)23-15(26)11-5-12(16(18,19)20)7-13(17)6-11/h5-9H,4H2,1-3H3,(H,23,26) |
| InChIKey | WDTQQGGTKNFGQW-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.79 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|