C15H13F6N5O2 — CID 166473565
N-[1-[2-[(E)-N-hydroxy-C-methylcarbonimidoyl]-1,2,4-triazol-3-yl]ethyl]-3,5-bis(trifluoromethyl)benzamide (PubChem CID 166473565) has the molecular formula C15H13F6N5O2 and a molecular weight of 409.29 g/mol. Its IUPAC name is N-[1-[2-[(E)-N-hydroxy-C-methylcarbonimidoyl]-1,2,4-triazol-3-yl]ethyl]-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-[1-[2-[(E)-N-hydroxy-C-methylcarbonimidoyl]-1,2,4-triazol-3-yl]ethyl]-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 166473565 |
| Molecular Formula | C15H13F6N5O2 |
| Molecular Weight | 409.29 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | N-[1-[2-[(E)-N-hydroxy-C-methylcarbonimidoyl]-1,2,4-triazol-3-yl]ethyl]-3,5-bis(trifluoromethyl)benzamide |
| SMILES | C/C(=N\O)n1ncnc1C(C)NC(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H13F6N5O2/c1-7(12-22-6-23-26(12)8(2)25-28)24-13(27)9-3-10(14(16,17)18)5-11(4-9)15(19,20)21/h3-7,28H,1-2H3,(H,24,27)/b25-8+ |
| InChIKey | OYBFBWSXGJTEDY-ZNLRHDTNSA-N |
| XLogP | 3.46 |
| TPSA | 92.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.29 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|