C33H38N2O5 — CID 17063345
6-(3,4-diethoxyphenyl)-9-(3-methoxy-4-propan-2-yloxyphenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one (PubChem CID 17063345) has the molecular formula C33H38N2O5 and a molecular weight of 542.68 g/mol. Its IUPAC name is 6-(3,4-diethoxyphenyl)-9-(3-methoxy-4-propan-2-yloxyphenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one.
| Compound Name | 6-(3,4-diethoxyphenyl)-9-(3-methoxy-4-propan-2-yloxyphenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 17063345 |
| Molecular Formula | C33H38N2O5 |
| Molecular Weight | 542.68 g/mol |
| Exact Mass | 542.28 |
| IUPAC Name | 6-(3,4-diethoxyphenyl)-9-(3-methoxy-4-propan-2-yloxyphenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
| SMILES | CCOc1ccc(C2Nc3ccccc3NC3=C2C(=O)CC(c2ccc(OC(C)C)c(OC)c2)C3)cc1OCC |
| InChI | InChI=1S/C33H38N2O5/c1-6-38-28-14-13-22(19-31(28)39-7-2)33-32-26(34-24-10-8-9-11-25(24)35-33)16-23(17-27(32)36)21-12-15-29(40-20(3)4)30(18-21)37-5/h8-15,18-20,23,33-35H,6-7,16-17H2,1-5H3 |
| InChIKey | YXOSLFVTZBHOKZ-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.68 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |