C32H36N2O3 — CID 17062091
6-(3-ethoxy-4-propan-2-yloxyphenyl)-9-(4-ethylphenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one (PubChem CID 17062091) has the molecular formula C32H36N2O3 and a molecular weight of 496.65 g/mol. Its IUPAC name is 6-(3-ethoxy-4-propan-2-yloxyphenyl)-9-(4-ethylphenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one.
| Compound Name | 6-(3-ethoxy-4-propan-2-yloxyphenyl)-9-(4-ethylphenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 17062091 |
| Molecular Formula | C32H36N2O3 |
| Molecular Weight | 496.65 g/mol |
| Exact Mass | 496.27 |
| IUPAC Name | 6-(3-ethoxy-4-propan-2-yloxyphenyl)-9-(4-ethylphenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
| SMILES | CCOc1cc(C2Nc3ccccc3NC3=C2C(=O)CC(c2ccc(CC)cc2)C3)ccc1OC(C)C |
| InChI | InChI=1S/C32H36N2O3/c1-5-21-11-13-22(14-12-21)24-17-27-31(28(35)18-24)32(34-26-10-8-7-9-25(26)33-27)23-15-16-29(37-20(3)4)30(19-23)36-6-2/h7-16,19-20,24,32-34H,5-6,17-18H2,1-4H3 |
| InChIKey | VYMUFENVXLDKKY-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.65 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |