C34H30Cl2N2O3 — CID 94484305
(6R,9S)-9-(4-chlorophenyl)-6-[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one (PubChem CID 94484305) has the molecular formula C34H30Cl2N2O3 and a molecular weight of 585.53 g/mol. Its IUPAC name is (6R,9S)-9-(4-chlorophenyl)-6-[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one.
| Compound Name | (6R,9S)-9-(4-chlorophenyl)-6-[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 94484305 |
| Molecular Formula | C34H30Cl2N2O3 |
| Molecular Weight | 585.53 g/mol |
| Exact Mass | 584.16 |
| IUPAC Name | (6R,9S)-9-(4-chlorophenyl)-6-[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
| SMILES | CCOc1cc([C@H]2Nc3ccccc3NC3=C2C(=O)C[C@@H](c2ccc(Cl)cc2)C3)ccc1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C34H30Cl2N2O3/c1-2-40-32-19-23(11-16-31(32)41-20-21-7-12-25(35)13-8-21)34-33-29(37-27-5-3-4-6-28(27)38-34)17-24(18-30(33)39)22-9-14-26(36)15-10-22/h3-16,19,24,34,37-38H,2,17-18,20H2,1H3/t24-,34+/m0/s1 |
| InChIKey | WKHDPUCKQSJOJS-YUYWZBKDSA-N |
| XLogP | 8.95 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.53 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |