C27H24Cl2N2O2 — CID 17064567
6-(3-chloro-4-ethoxyphenyl)-9-(4-chlorophenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one (PubChem CID 17064567) has the molecular formula C27H24Cl2N2O2 and a molecular weight of 479.41 g/mol. Its IUPAC name is 6-(3-chloro-4-ethoxyphenyl)-9-(4-chlorophenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one.
| Compound Name | 6-(3-chloro-4-ethoxyphenyl)-9-(4-chlorophenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 17064567 |
| Molecular Formula | C27H24Cl2N2O2 |
| Molecular Weight | 479.41 g/mol |
| Exact Mass | 478.12 |
| IUPAC Name | 6-(3-chloro-4-ethoxyphenyl)-9-(4-chlorophenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
| SMILES | CCOc1ccc(C2Nc3ccccc3NC3=C2C(=O)CC(c2ccc(Cl)cc2)C3)cc1Cl |
| InChI | InChI=1S/C27H24Cl2N2O2/c1-2-33-25-12-9-17(13-20(25)29)27-26-23(30-21-5-3-4-6-22(21)31-27)14-18(15-24(26)32)16-7-10-19(28)11-8-16/h3-13,18,27,30-31H,2,14-15H2,1H3 |
| InChIKey | KWROBDOJCBEMRL-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.41 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |