C31H31NO3 — CID 170633581
[(8R,9S,13S,14S)-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] 4-methyl-3-pyridin-2-ylbenzoate (PubChem CID 170633581) has the molecular formula C31H31NO3 and a molecular weight of 465.59 g/mol. Its IUPAC name is [(8R,9S,13S,14S)-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] 4-methyl-3-pyridin-2-ylbenzoate.
| Compound Name | [(8R,9S,13S,14S)-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] 4-methyl-3-pyridin-2-ylbenzoate |
|---|---|
| PubChem CID | 170633581 |
| Molecular Formula | C31H31NO3 |
| Molecular Weight | 465.59 g/mol |
| Exact Mass | 465.23 |
| IUPAC Name | [(8R,9S,13S,14S)-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] 4-methyl-3-pyridin-2-ylbenzoate |
| SMILES | Cc1ccc(C(=O)Oc2ccc3c(c2)CC[C@@H]2[C@@H]3CC[C@]3(C)C(=O)CC[C@@H]23)cc1-c1ccccn1 |
| InChI | InChI=1S/C31H31NO3/c1-19-6-7-21(18-26(19)28-5-3-4-16-32-28)30(34)35-22-9-11-23-20(17-22)8-10-25-24(23)14-15-31(2)27(25)12-13-29(31)33/h3-7,9,11,16-18,24-25,27H,8,10,12-15H2,1-2H3/t24-,25-,27+,31+/m1/s1 |
| InChIKey | WOPKDJXDMUDZTE-RIQGMHGPSA-N |
| XLogP | 6.70 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.59 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|