C30H46N6O3S — CID 170633612
(2E,4Z,6E,7Z)-2,8-diamino-7-ethanethioyl-3-ethyl-6-ethylidene-9-methoxy-N-[2-methyl-5-[(2-pyrrolidin-1-ylacetyl)amino]-3-pyridinyl]nona-2,4,7-trienamide;ethane (PubChem CID 170633612) has the molecular formula C30H46N6O3S and a molecular weight of 570.80 g/mol. Its IUPAC name is (2E,4Z,6E,7Z)-2,8-diamino-7-ethanethioyl-3-ethyl-6-ethylidene-9-methoxy-N-[2-methyl-5-[(2-pyrrolidin-1-ylacetyl)amino]-3-pyridinyl]nona-2,4,7-trienamide;ethane.
| Compound Name | (2E,4Z,6E,7Z)-2,8-diamino-7-ethanethioyl-3-ethyl-6-ethylidene-9-methoxy-N-[2-methyl-5-[(2-pyrrolidin-1-ylacetyl)amino]-3-pyridinyl]nona-2,4,7-trienamide;ethane |
|---|---|
| PubChem CID | 170633612 |
| Molecular Formula | C30H46N6O3S |
| Molecular Weight | 570.80 g/mol |
| Exact Mass | 570.34 |
| IUPAC Name | (2E,4Z,6E,7Z)-2,8-diamino-7-ethanethioyl-3-ethyl-6-ethylidene-9-methoxy-N-[2-methyl-5-[(2-pyrrolidin-1-ylacetyl)amino]-3-pyridinyl]nona-2,4,7-trienamide;ethane |
| SMILES | C/C=C(\C=C/C(CC)=C(/N)C(=O)Nc1cc(NC(=O)CN2CCCC2)cnc1C)C(/C(C)=S)=C(/N)COC.CC |
| InChI | InChI=1S/C28H40N6O3S.C2H6/c1-6-20(26(19(4)38)23(29)17-37-5)10-11-21(7-2)27(30)28(36)33-24-14-22(15-31-18(24)3)32-25(35)16-34-12-8-9-13-34;1-2/h6,10-11,14-15H,7-9,12-13,16-17,29-30H2,1-5H3,(H,32,35)(H,33,36);1-2H3/b11-10-,20-6+,26-23+,27-21+; |
| InChIKey | OOJCDDWRPLJSMR-DLOFWFRQSA-N |
| XLogP | 4.76 |
| TPSA | 135.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.80 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|