C25H42O2 — CID 170636062
butane;ethane;(Z,2E)-2-ethylidene-1-(2-hydroxy-4-methylphenyl)-3-prop-1-en-2-ylpent-3-en-1-one (PubChem CID 170636062) has the molecular formula C25H42O2 and a molecular weight of 374.61 g/mol. Its IUPAC name is butane;ethane;(Z,2E)-2-ethylidene-1-(2-hydroxy-4-methylphenyl)-3-prop-1-en-2-ylpent-3-en-1-one.
| Compound Name | butane;ethane;(Z,2E)-2-ethylidene-1-(2-hydroxy-4-methylphenyl)-3-prop-1-en-2-ylpent-3-en-1-one |
|---|---|
| PubChem CID | 170636062 |
| Molecular Formula | C25H42O2 |
| Molecular Weight | 374.61 g/mol |
| Exact Mass | 374.32 |
| IUPAC Name | butane;ethane;(Z,2E)-2-ethylidene-1-(2-hydroxy-4-methylphenyl)-3-prop-1-en-2-ylpent-3-en-1-one |
| SMILES | C=C(C)C(=C/C)/C(=C\C)C(=O)c1ccc(C)cc1O.CC.CC.CCCC |
| InChI | InChI=1S/C17H20O2.C4H10.2C2H6/c1-6-13(11(3)4)14(7-2)17(19)15-9-8-12(5)10-16(15)18;1-3-4-2;2*1-2/h6-10,18H,3H2,1-2,4-5H3;3-4H2,1-2H3;2*1-2H3/b13-6-,14-7+;;; |
| InChIKey | JRYORRLVIARLDP-ZFTPCHOCSA-N |
| XLogP | 8.21 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.61 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|