About (3S)-6,6-dimethyl-3-(methylamino)hept-1-en-2-ol
(3S)-6,6-dimethyl-3-(methylamino)hept-1-en-2-ol (PubChem CID 170636810) has the molecular formula C10H21NO
and a molecular weight of 171.28 g/mol. Its IUPAC name is (3S)-6,6-dimethyl-3-(methylamino)hept-1-en-2-ol.
Molecular Properties
| Compound Name | (3S)-6,6-dimethyl-3-(methylamino)hept-1-en-2-ol |
| PubChem CID | 170636810 |
| Molecular Formula | C10H21NO |
| Molecular Weight | 171.28 g/mol |
| Exact Mass | 171.16 |
| IUPAC Name | (3S)-6,6-dimethyl-3-(methylamino)hept-1-en-2-ol |
| SMILES | C=C(O)[C@H](CCC(C)(C)C)NC |
| InChI | InChI=1S/C10H21NO/c1-8(12)9(11-5)6-7-10(2,3)4/h9,11-12H,1,6-7H2,2-5H3/t9-/m0/s1 |
| InChIKey | IRGREVXCNSFVHI-VIFPVBQESA-N |
| XLogP | 2.47 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.28 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze (3S)-6,6-dimethyl-3-(methylamino)hept-1-en-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-6,6-dimethyl-3-(methylamino)hept-1-en-2-ol?
The IUPAC name of (3S)-6,6-dimethyl-3-(methylamino)hept-1-en-2-ol (CID 170636810) is (3S)-6,6-dimethyl-3-(methylamino)hept-1-en-2-ol.
What is the SMILES notation for (3S)-6,6-dimethyl-3-(methylamino)hept-1-en-2-ol?
The canonical SMILES for (3S)-6,6-dimethyl-3-(methylamino)hept-1-en-2-ol is C=C(O)[C@H](CCC(C)(C)C)NC.
What is the InChIKey of (3S)-6,6-dimethyl-3-(methylamino)hept-1-en-2-ol?
The InChIKey is IRGREVXCNSFVHI-VIFPVBQESA-N. The full InChI is InChI=1S/C10H21NO/c1-8(12)9(11-5)6-7-10(2,3)4/h9,11-12H,1,6-7H2,2-5H3/t9-/m0/s1.
What are the key properties of (3S)-6,6-dimethyl-3-(methylamino)hept-1-en-2-ol?
(3S)-6,6-dimethyl-3-(methylamino)hept-1-en-2-ol has a molecular weight of 171.28 g/mol, XLogP of 2.47, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-6,6-dimethyl-3-(methylamino)hept-1-en-2-ol is sourced from PubChem (CID 170636810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).