C30H39N3O8 — CID 170636811
methyl (2S)-5,5-dimethyl-2-[[6-[3-[2-oxo-2-[2-(2-prop-2-ynoxyethoxy)ethylamino]ethoxy]phenoxy]pyridine-3-carbonyl]amino]hexanoate (PubChem CID 170636811) has the molecular formula C30H39N3O8 and a molecular weight of 569.66 g/mol. Its IUPAC name is methyl (2S)-5,5-dimethyl-2-[[6-[3-[2-oxo-2-[2-(2-prop-2-ynoxyethoxy)ethylamino]ethoxy]phenoxy]pyridine-3-carbonyl]amino]hexanoate.
| Compound Name | methyl (2S)-5,5-dimethyl-2-[[6-[3-[2-oxo-2-[2-(2-prop-2-ynoxyethoxy)ethylamino]ethoxy]phenoxy]pyridine-3-carbonyl]amino]hexanoate |
|---|---|
| PubChem CID | 170636811 |
| Molecular Formula | C30H39N3O8 |
| Molecular Weight | 569.66 g/mol |
| Exact Mass | 569.27 |
| IUPAC Name | methyl (2S)-5,5-dimethyl-2-[[6-[3-[2-oxo-2-[2-(2-prop-2-ynoxyethoxy)ethylamino]ethoxy]phenoxy]pyridine-3-carbonyl]amino]hexanoate |
| SMILES | C#CCOCCOCCNC(=O)COc1cccc(Oc2ccc(C(=O)N[C@@H](CCC(C)(C)C)C(=O)OC)cn2)c1 |
| InChI | InChI=1S/C30H39N3O8/c1-6-15-38-17-18-39-16-14-31-26(34)21-40-23-8-7-9-24(19-23)41-27-11-10-22(20-32-27)28(35)33-25(29(36)37-5)12-13-30(2,3)4/h1,7-11,19-20,25H,12-18,21H2,2-5H3,(H,31,34)(H,33,35)/t25-/m0/s1 |
| InChIKey | PBAUWDQFQJJIDT-VWLOTQADSA-N |
| XLogP | 3.13 |
| TPSA | 134.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.66 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|