C17H12ClN3O4 — CID 170637038
2-[[3-[4-[(5-chloro-3-pyridinyl)oxy]phenyl]-1,2,4-oxadiazol-5-yl]methyl]prop-2-enoic acid (PubChem CID 170637038) has the molecular formula C17H12ClN3O4 and a molecular weight of 357.75 g/mol. Its IUPAC name is 2-[[3-[4-[(5-chloro-3-pyridinyl)oxy]phenyl]-1,2,4-oxadiazol-5-yl]methyl]prop-2-enoic acid.
| Compound Name | 2-[[3-[4-[(5-chloro-3-pyridinyl)oxy]phenyl]-1,2,4-oxadiazol-5-yl]methyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 170637038 |
| Molecular Formula | C17H12ClN3O4 |
| Molecular Weight | 357.75 g/mol |
| Exact Mass | 357.05 |
| IUPAC Name | 2-[[3-[4-[(5-chloro-3-pyridinyl)oxy]phenyl]-1,2,4-oxadiazol-5-yl]methyl]prop-2-enoic acid |
| SMILES | C=C(Cc1nc(-c2ccc(Oc3cncc(Cl)c3)cc2)no1)C(=O)O |
| InChI | InChI=1S/C17H12ClN3O4/c1-10(17(22)23)6-15-20-16(21-25-15)11-2-4-13(5-3-11)24-14-7-12(18)8-19-9-14/h2-5,7-9H,1,6H2,(H,22,23) |
| InChIKey | JILNSOOZGLEBFP-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 98.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.75 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|