C30H32N2O3 — CID 17063861
6-(4-butan-2-yloxyphenyl)-9-(4-methoxyphenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one (PubChem CID 17063861) has the molecular formula C30H32N2O3 and a molecular weight of 468.60 g/mol. Its IUPAC name is 6-(4-butan-2-yloxyphenyl)-9-(4-methoxyphenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one.
| Compound Name | 6-(4-butan-2-yloxyphenyl)-9-(4-methoxyphenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 17063861 |
| Molecular Formula | C30H32N2O3 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.24 |
| IUPAC Name | 6-(4-butan-2-yloxyphenyl)-9-(4-methoxyphenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
| SMILES | CCC(C)Oc1ccc(C2Nc3ccccc3NC3=C2C(=O)CC(c2ccc(OC)cc2)C3)cc1 |
| InChI | InChI=1S/C30H32N2O3/c1-4-19(2)35-24-15-11-21(12-16-24)30-29-27(31-25-7-5-6-8-26(25)32-30)17-22(18-28(29)33)20-9-13-23(34-3)14-10-20/h5-16,19,22,30-32H,4,17-18H2,1-3H3 |
| InChIKey | NKBJGZGGJCTHTN-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |