C25H32F4N6OS — CID 170638736
5-cyclohexyl-7-fluoro-1-methylindazole;3-methoxy-1-pyridazin-3-yl-N-(trifluoromethylsulfanyl)piperidin-4-amine (PubChem CID 170638736) has the molecular formula C25H32F4N6OS and a molecular weight of 540.63 g/mol. Its IUPAC name is 5-cyclohexyl-7-fluoro-1-methylindazole;3-methoxy-1-pyridazin-3-yl-N-(trifluoromethylsulfanyl)piperidin-4-amine.
| Compound Name | 5-cyclohexyl-7-fluoro-1-methylindazole;3-methoxy-1-pyridazin-3-yl-N-(trifluoromethylsulfanyl)piperidin-4-amine |
|---|---|
| PubChem CID | 170638736 |
| Molecular Formula | C25H32F4N6OS |
| Molecular Weight | 540.63 g/mol |
| Exact Mass | 540.23 |
| IUPAC Name | 5-cyclohexyl-7-fluoro-1-methylindazole;3-methoxy-1-pyridazin-3-yl-N-(trifluoromethylsulfanyl)piperidin-4-amine |
| SMILES | COC1CN(c2cccnn2)CCC1NSC(F)(F)F.Cn1ncc2cc(C3CCCCC3)cc(F)c21 |
| InChI | InChI=1S/C14H17FN2.C11H15F3N4OS/c1-17-14-12(9-16-17)7-11(8-13(14)15)10-5-3-2-4-6-10;1-19-9-7-18(10-3-2-5-15-16-10)6-4-8(9)17-20-11(12,13)14/h7-10H,2-6H2,1H3;2-3,5,8-9,17H,4,6-7H2,1H3 |
| InChIKey | WJRQSLGTVJXOTC-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 68.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.63 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|