C24H36N4O8 — CID 170639222
3-[(3Z,4E)-3-[1-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethylamino]prop-2-enylidene]-4-ethylidene-2,5-dioxopyrrolidin-1-yl]piperidine-2,6-dione (PubChem CID 170639222) has the molecular formula C24H36N4O8 and a molecular weight of 508.57 g/mol. Its IUPAC name is 3-[(3Z,4E)-3-[1-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethylamino]prop-2-enylidene]-4-ethylidene-2,5-dioxopyrrolidin-1-yl]piperidine-2,6-dione.
| Compound Name | 3-[(3Z,4E)-3-[1-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethylamino]prop-2-enylidene]-4-ethylidene-2,5-dioxopyrrolidin-1-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 170639222 |
| Molecular Formula | C24H36N4O8 |
| Molecular Weight | 508.57 g/mol |
| Exact Mass | 508.25 |
| IUPAC Name | 3-[(3Z,4E)-3-[1-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethylamino]prop-2-enylidene]-4-ethylidene-2,5-dioxopyrrolidin-1-yl]piperidine-2,6-dione |
| SMILES | C=C/C(NCCOCCOCCOCCOCCN)=C1/C(=O)N(C2CCC(=O)NC2=O)C(=O)/C1=C/C |
| InChI | InChI=1S/C24H36N4O8/c1-3-17-21(24(32)28(23(17)31)19-5-6-20(29)27-22(19)30)18(4-2)26-8-10-34-12-14-36-16-15-35-13-11-33-9-7-25/h3-4,19,26H,2,5-16,25H2,1H3,(H,27,29,30)/b17-3+,21-18- |
| InChIKey | YMBBYPQIVOYWMP-JIUXHYLLSA-N |
| XLogP | -0.84 |
| TPSA | 158.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.57 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|