C18H35N3O6S — CID 170639226
2-propan-2-yloxy-N-[2-[(E)-2-[2-(4-propylsulfonylpiperazin-1-yl)ethoxy]ethenoxy]ethyl]acetamide (PubChem CID 170639226) has the molecular formula C18H35N3O6S and a molecular weight of 421.56 g/mol. Its IUPAC name is 2-propan-2-yloxy-N-[2-[(E)-2-[2-(4-propylsulfonylpiperazin-1-yl)ethoxy]ethenoxy]ethyl]acetamide.
| Compound Name | 2-propan-2-yloxy-N-[2-[(E)-2-[2-(4-propylsulfonylpiperazin-1-yl)ethoxy]ethenoxy]ethyl]acetamide |
|---|---|
| PubChem CID | 170639226 |
| Molecular Formula | C18H35N3O6S |
| Molecular Weight | 421.56 g/mol |
| Exact Mass | 421.22 |
| IUPAC Name | 2-propan-2-yloxy-N-[2-[(E)-2-[2-(4-propylsulfonylpiperazin-1-yl)ethoxy]ethenoxy]ethyl]acetamide |
| SMILES | CCCS(=O)(=O)N1CCN(CCO/C=C/OCCNC(=O)COC(C)C)CC1 |
| InChI | InChI=1S/C18H35N3O6S/c1-4-15-28(23,24)21-8-6-20(7-9-21)10-12-26-14-13-25-11-5-19-18(22)16-27-17(2)3/h13-14,17H,4-12,15-16H2,1-3H3,(H,19,22)/b14-13+ |
| InChIKey | WPPNOQDIAFIRQS-BUHFOSPRSA-N |
| XLogP | 0.39 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.56 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|