C28H28N2O3 — CID 17063998
9-(4-ethylphenyl)-6-(2-hydroxy-3-methoxyphenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one (PubChem CID 17063998) has the molecular formula C28H28N2O3 and a molecular weight of 440.54 g/mol. Its IUPAC name is 9-(4-ethylphenyl)-6-(2-hydroxy-3-methoxyphenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one.
| Compound Name | 9-(4-ethylphenyl)-6-(2-hydroxy-3-methoxyphenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 17063998 |
| Molecular Formula | C28H28N2O3 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | 9-(4-ethylphenyl)-6-(2-hydroxy-3-methoxyphenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
| SMILES | CCc1ccc(C2CC(=O)C3=C(C2)Nc2ccccc2NC3c2cccc(OC)c2O)cc1 |
| InChI | InChI=1S/C28H28N2O3/c1-3-17-11-13-18(14-12-17)19-15-23-26(24(31)16-19)27(20-7-6-10-25(33-2)28(20)32)30-22-9-5-4-8-21(22)29-23/h4-14,19,27,29-30,32H,3,15-16H2,1-2H3 |
| InChIKey | JTYOALNOSIFUCN-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|