C12H20N2O — CID 170641269
N,5-diethyl-N-(2-methoxyethyl)pyridin-2-amine (PubChem CID 170641269) has the molecular formula C12H20N2O and a molecular weight of 208.30 g/mol. Its IUPAC name is N,5-diethyl-N-(2-methoxyethyl)pyridin-2-amine.
| Compound Name | N,5-diethyl-N-(2-methoxyethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 170641269 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | N,5-diethyl-N-(2-methoxyethyl)pyridin-2-amine |
| SMILES | CCc1ccc(N(CC)CCOC)nc1 |
| InChI | InChI=1S/C12H20N2O/c1-4-11-6-7-12(13-10-11)14(5-2)8-9-15-3/h6-7,10H,4-5,8-9H2,1-3H3 |
| InChIKey | HYFPGANDWYVQAN-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |