C13H19FN2 — CID 170641393
1-(3-fluorophenyl)-4,6-dimethyl-1,4-diazepane (PubChem CID 170641393) has the molecular formula C13H19FN2 and a molecular weight of 222.31 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-4,6-dimethyl-1,4-diazepane.
| Compound Name | 1-(3-fluorophenyl)-4,6-dimethyl-1,4-diazepane |
|---|---|
| PubChem CID | 170641393 |
| Molecular Formula | C13H19FN2 |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | 1-(3-fluorophenyl)-4,6-dimethyl-1,4-diazepane |
| SMILES | CC1CN(C)CCN(c2cccc(F)c2)C1 |
| InChI | InChI=1S/C13H19FN2/c1-11-9-15(2)6-7-16(10-11)13-5-3-4-12(14)8-13/h3-5,8,11H,6-7,9-10H2,1-2H3 |
| InChIKey | FELPVHWLQCWCJI-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |