C21H24N2O8S — CID 17064269
ethyl 5-[(2,5-dimethoxyphenyl)carbamoyl]-2-[(2-ethoxy-2-oxoacetyl)amino]-4-methylthiophene-3-carboxylate (PubChem CID 17064269) has the molecular formula C21H24N2O8S and a molecular weight of 464.50 g/mol. Its IUPAC name is ethyl 5-[(2,5-dimethoxyphenyl)carbamoyl]-2-[(2-ethoxy-2-oxoacetyl)amino]-4-methylthiophene-3-carboxylate.
| Compound Name | ethyl 5-[(2,5-dimethoxyphenyl)carbamoyl]-2-[(2-ethoxy-2-oxoacetyl)amino]-4-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 17064269 |
| Molecular Formula | C21H24N2O8S |
| Molecular Weight | 464.50 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | ethyl 5-[(2,5-dimethoxyphenyl)carbamoyl]-2-[(2-ethoxy-2-oxoacetyl)amino]-4-methylthiophene-3-carboxylate |
| SMILES | CCOC(=O)C(=O)Nc1sc(C(=O)Nc2cc(OC)ccc2OC)c(C)c1C(=O)OCC |
| InChI | InChI=1S/C21H24N2O8S/c1-6-30-20(26)15-11(3)16(32-19(15)23-18(25)21(27)31-7-2)17(24)22-13-10-12(28-4)8-9-14(13)29-5/h8-10H,6-7H2,1-5H3,(H,22,24)(H,23,25) |
| InChIKey | PYRBQWRRSOAQQQ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.50 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|