C20H20N2O8S — CID 2977261
methyl 2-[(2-ethoxy-2-oxoacetyl)amino]-5-[(2-methoxycarbonylphenyl)carbamoyl]-4-methylthiophene-3-carboxylate (PubChem CID 2977261) has the molecular formula C20H20N2O8S and a molecular weight of 448.45 g/mol. Its IUPAC name is methyl 2-[(2-ethoxy-2-oxoacetyl)amino]-5-[(2-methoxycarbonylphenyl)carbamoyl]-4-methylthiophene-3-carboxylate.
| Compound Name | methyl 2-[(2-ethoxy-2-oxoacetyl)amino]-5-[(2-methoxycarbonylphenyl)carbamoyl]-4-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 2977261 |
| Molecular Formula | C20H20N2O8S |
| Molecular Weight | 448.45 g/mol |
| Exact Mass | 448.09 |
| IUPAC Name | methyl 2-[(2-ethoxy-2-oxoacetyl)amino]-5-[(2-methoxycarbonylphenyl)carbamoyl]-4-methylthiophene-3-carboxylate |
| SMILES | CCOC(=O)C(=O)Nc1sc(C(=O)Nc2ccccc2C(=O)OC)c(C)c1C(=O)OC |
| InChI | InChI=1S/C20H20N2O8S/c1-5-30-20(27)16(24)22-17-13(19(26)29-4)10(2)14(31-17)15(23)21-12-9-7-6-8-11(12)18(25)28-3/h6-9H,5H2,1-4H3,(H,21,23)(H,22,24) |
| InChIKey | DMBPNIGIRNTRTB-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 137.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.45 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|