C18H20Cl2N2O3S — CID 170643801
tert-butyl N-[(1S,6S)-6-(3,5-dichloro-7-oxo-4H-thieno[3,2-b]pyridin-2-yl)cyclohex-3-en-1-yl]carbamate (PubChem CID 170643801) has the molecular formula C18H20Cl2N2O3S and a molecular weight of 415.34 g/mol. Its IUPAC name is tert-butyl N-[(1S,6S)-6-(3,5-dichloro-7-oxo-4H-thieno[3,2-b]pyridin-2-yl)cyclohex-3-en-1-yl]carbamate.
| Compound Name | tert-butyl N-[(1S,6S)-6-(3,5-dichloro-7-oxo-4H-thieno[3,2-b]pyridin-2-yl)cyclohex-3-en-1-yl]carbamate |
|---|---|
| PubChem CID | 170643801 |
| Molecular Formula | C18H20Cl2N2O3S |
| Molecular Weight | 415.34 g/mol |
| Exact Mass | 414.06 |
| IUPAC Name | tert-butyl N-[(1S,6S)-6-(3,5-dichloro-7-oxo-4H-thieno[3,2-b]pyridin-2-yl)cyclohex-3-en-1-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CC=CC[C@@H]1c1sc2c(=O)cc(Cl)[nH]c2c1Cl |
| InChI | InChI=1S/C18H20Cl2N2O3S/c1-18(2,3)25-17(24)21-10-7-5-4-6-9(10)15-13(20)14-16(26-15)11(23)8-12(19)22-14/h4-5,8-10H,6-7H2,1-3H3,(H,21,24)(H,22,23)/t9-,10-/m0/s1 |
| InChIKey | BOAARSFBXKHDSJ-UWVGGRQHSA-N |
| XLogP | 5.22 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.34 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|