C9H18N2 — CID 170645003
ethane;5-ethyl-2-methyl-1,2-dihydropyrimidine (PubChem CID 170645003) has the molecular formula C9H18N2 and a molecular weight of 154.26 g/mol. Its IUPAC name is ethane;5-ethyl-2-methyl-1,2-dihydropyrimidine.
| Compound Name | ethane;5-ethyl-2-methyl-1,2-dihydropyrimidine |
|---|---|
| PubChem CID | 170645003 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | ethane;5-ethyl-2-methyl-1,2-dihydropyrimidine |
| SMILES | CC.CCC1=CNC(C)N=C1 |
| InChI | InChI=1S/C7H12N2.C2H6/c1-3-7-4-8-6(2)9-5-7;1-2/h4-6,8H,3H2,1-2H3;1-2H3 |
| InChIKey | FQPIFFPRLOZRSI-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |