C32H26N4O5 — CID 170645157
2-[3-[3-(4-formyl-3,5-dimethoxyanilino)-2-methanimidoylphenyl]-2-methylphenyl]-5-(hydroxymethyl)-1,3-benzoxazole-7-carbonitrile (PubChem CID 170645157) has the molecular formula C32H26N4O5 and a molecular weight of 546.58 g/mol. Its IUPAC name is 2-[3-[3-(4-formyl-3,5-dimethoxyanilino)-2-methanimidoylphenyl]-2-methylphenyl]-5-(hydroxymethyl)-1,3-benzoxazole-7-carbonitrile.
| Compound Name | 2-[3-[3-(4-formyl-3,5-dimethoxyanilino)-2-methanimidoylphenyl]-2-methylphenyl]-5-(hydroxymethyl)-1,3-benzoxazole-7-carbonitrile |
|---|---|
| PubChem CID | 170645157 |
| Molecular Formula | C32H26N4O5 |
| Molecular Weight | 546.58 g/mol |
| Exact Mass | 546.19 |
| IUPAC Name | 2-[3-[3-(4-formyl-3,5-dimethoxyanilino)-2-methanimidoylphenyl]-2-methylphenyl]-5-(hydroxymethyl)-1,3-benzoxazole-7-carbonitrile |
| SMILES | [H]/N=C/c1c(Nc2cc(OC)c(C=O)c(OC)c2)cccc1-c1cccc(-c2nc3cc(CO)cc(C#N)c3o2)c1C |
| InChI | InChI=1S/C32H26N4O5/c1-18-22(6-4-7-23(18)32-36-28-11-19(16-37)10-20(14-33)31(28)41-32)24-8-5-9-27(25(24)15-34)35-21-12-29(39-2)26(17-38)30(13-21)40-3/h4-13,15,17,34-35,37H,16H2,1-3H3/b34-15+ |
| InChIKey | BKJNVJHBQVBESG-PUHLOBNQSA-N |
| XLogP | 6.41 |
| TPSA | 141.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.58 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|