C32H31ClFN3O4 — CID 170645134
4-[3-[2-chloro-3-[4-[(dimethylamino)methyl]-3-fluoro-5-methoxyphenyl]phenyl]-2-methanimidoylanilino]-2,6-dimethoxybenzaldehyde (PubChem CID 170645134) has the molecular formula C32H31ClFN3O4 and a molecular weight of 576.07 g/mol. Its IUPAC name is 4-[3-[2-chloro-3-[4-[(dimethylamino)methyl]-3-fluoro-5-methoxyphenyl]phenyl]-2-methanimidoylanilino]-2,6-dimethoxybenzaldehyde.
| Compound Name | 4-[3-[2-chloro-3-[4-[(dimethylamino)methyl]-3-fluoro-5-methoxyphenyl]phenyl]-2-methanimidoylanilino]-2,6-dimethoxybenzaldehyde |
|---|---|
| PubChem CID | 170645134 |
| Molecular Formula | C32H31ClFN3O4 |
| Molecular Weight | 576.07 g/mol |
| Exact Mass | 575.20 |
| IUPAC Name | 4-[3-[2-chloro-3-[4-[(dimethylamino)methyl]-3-fluoro-5-methoxyphenyl]phenyl]-2-methanimidoylanilino]-2,6-dimethoxybenzaldehyde |
| SMILES | [H]/N=C/c1c(Nc2cc(OC)c(C=O)c(OC)c2)cccc1-c1cccc(-c2cc(F)c(CN(C)C)c(OC)c2)c1Cl |
| InChI | InChI=1S/C32H31ClFN3O4/c1-37(2)17-25-27(34)12-19(13-29(25)39-3)21-8-6-10-23(32(21)33)22-9-7-11-28(24(22)16-35)36-20-14-30(40-4)26(18-38)31(15-20)41-5/h6-16,18,35-36H,17H2,1-5H3/b35-16+ |
| InChIKey | UWEWIWSVAXTXFT-QNVXDBMFSA-N |
| XLogP | 7.45 |
| TPSA | 83.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.07 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|