C22H37BO6 — CID 170645547
CID 170645547 (PubChem CID 170645547) has the molecular formula C22H37BO6 and a molecular weight of 408.34 g/mol.
| Compound Name | CID 170645547 |
|---|---|
| PubChem CID | 170645547 |
| Molecular Formula | C22H37BO6 |
| Molecular Weight | 408.34 g/mol |
| Exact Mass | 408.27 |
| IUPAC Name | — |
| SMILES | [B]c1c(OC)cc(COCCOC(C)(C)CCOC(C)(C)CCOC)cc1OC |
| InChI | InChI=1S/C22H37BO6/c1-21(2,8-10-24-5)28-11-9-22(3,4)29-13-12-27-16-17-14-18(25-6)20(23)19(15-17)26-7/h14-15H,8-13,16H2,1-7H3 |
| InChIKey | RUZVEGNPQROALB-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.34 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|