C17H14ClN3O2 — CID 170647940
(E)-3-[1-[(4-chlorophenyl)methyl]indazol-5-yl]-N-hydroxyprop-2-enamide (PubChem CID 170647940) has the molecular formula C17H14ClN3O2 and a molecular weight of 327.77 g/mol. Its IUPAC name is (E)-3-[1-[(4-chlorophenyl)methyl]indazol-5-yl]-N-hydroxyprop-2-enamide.
| Compound Name | (E)-3-[1-[(4-chlorophenyl)methyl]indazol-5-yl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 170647940 |
| Molecular Formula | C17H14ClN3O2 |
| Molecular Weight | 327.77 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | (E)-3-[1-[(4-chlorophenyl)methyl]indazol-5-yl]-N-hydroxyprop-2-enamide |
| SMILES | O=C(/C=C/c1ccc2c(cnn2Cc2ccc(Cl)cc2)c1)NO |
| InChI | InChI=1S/C17H14ClN3O2/c18-15-5-1-13(2-6-15)11-21-16-7-3-12(4-8-17(22)20-23)9-14(16)10-19-21/h1-10,23H,11H2,(H,20,22)/b8-4+ |
| InChIKey | YCRYCSPDQOWLIE-XBXARRHUSA-N |
| XLogP | 3.26 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.77 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|