C28H26FN7O — CID 170648910
7-[4-[5-(2-fluoro-3-pyridinyl)-1-(oxan-2-yl)indazol-3-yl]triazol-1-yl]-1,2,3,4-tetrahydroisoquinoline (PubChem CID 170648910) has the molecular formula C28H26FN7O and a molecular weight of 495.56 g/mol. Its IUPAC name is 7-[4-[5-(2-fluoro-3-pyridinyl)-1-(oxan-2-yl)indazol-3-yl]triazol-1-yl]-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 7-[4-[5-(2-fluoro-3-pyridinyl)-1-(oxan-2-yl)indazol-3-yl]triazol-1-yl]-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 170648910 |
| Molecular Formula | C28H26FN7O |
| Molecular Weight | 495.56 g/mol |
| Exact Mass | 495.22 |
| IUPAC Name | 7-[4-[5-(2-fluoro-3-pyridinyl)-1-(oxan-2-yl)indazol-3-yl]triazol-1-yl]-1,2,3,4-tetrahydroisoquinoline |
| SMILES | Fc1ncccc1-c1ccc2c(c1)c(-c1cn(-c3ccc4c(c3)CNCC4)nn1)nn2C1CCCCO1 |
| InChI | InChI=1S/C28H26FN7O/c29-28-22(4-3-11-31-28)19-7-9-25-23(15-19)27(33-36(25)26-5-1-2-13-37-26)24-17-35(34-32-24)21-8-6-18-10-12-30-16-20(18)14-21/h3-4,6-9,11,14-15,17,26,30H,1-2,5,10,12-13,16H2 |
| InChIKey | DUZSTTTXCJBYGH-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 82.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.56 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|