C29H28FN7O — CID 170649073
7-[4-[5-(2-fluoro-3-pyridinyl)-1-(oxan-2-yl)indazol-3-yl]triazol-1-yl]-1-methyl-1,2,3,4-tetrahydroisoquinoline (PubChem CID 170649073) has the molecular formula C29H28FN7O and a molecular weight of 509.59 g/mol. Its IUPAC name is 7-[4-[5-(2-fluoro-3-pyridinyl)-1-(oxan-2-yl)indazol-3-yl]triazol-1-yl]-1-methyl-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 7-[4-[5-(2-fluoro-3-pyridinyl)-1-(oxan-2-yl)indazol-3-yl]triazol-1-yl]-1-methyl-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 170649073 |
| Molecular Formula | C29H28FN7O |
| Molecular Weight | 509.59 g/mol |
| Exact Mass | 509.23 |
| IUPAC Name | 7-[4-[5-(2-fluoro-3-pyridinyl)-1-(oxan-2-yl)indazol-3-yl]triazol-1-yl]-1-methyl-1,2,3,4-tetrahydroisoquinoline |
| SMILES | CC1NCCc2ccc(-n3cc(-c4nn(C5CCCCO5)c5ccc(-c6cccnc6F)cc45)nn3)cc21 |
| InChI | InChI=1S/C29H28FN7O/c1-18-23-16-21(9-7-19(23)11-13-31-18)36-17-25(33-35-36)28-24-15-20(22-5-4-12-32-29(22)30)8-10-26(24)37(34-28)27-6-2-3-14-38-27/h4-5,7-10,12,15-18,27,31H,2-3,6,11,13-14H2,1H3 |
| InChIKey | PFPQVGDHEGHXQH-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 82.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.59 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|