C23H19FN6O3 — CID 170649080
5-(2-fluoro-3-pyridinyl)-3-[1-(3,4,5-trimethoxyphenyl)triazol-4-yl]-1H-indazole (PubChem CID 170649080) has the molecular formula C23H19FN6O3 and a molecular weight of 446.44 g/mol. Its IUPAC name is 5-(2-fluoro-3-pyridinyl)-3-[1-(3,4,5-trimethoxyphenyl)triazol-4-yl]-1H-indazole.
| Compound Name | 5-(2-fluoro-3-pyridinyl)-3-[1-(3,4,5-trimethoxyphenyl)triazol-4-yl]-1H-indazole |
|---|---|
| PubChem CID | 170649080 |
| Molecular Formula | C23H19FN6O3 |
| Molecular Weight | 446.44 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | 5-(2-fluoro-3-pyridinyl)-3-[1-(3,4,5-trimethoxyphenyl)triazol-4-yl]-1H-indazole |
| SMILES | COc1cc(-n2cc(-c3n[nH]c4ccc(-c5cccnc5F)cc34)nn2)cc(OC)c1OC |
| InChI | InChI=1S/C23H19FN6O3/c1-31-19-10-14(11-20(32-2)22(19)33-3)30-12-18(27-29-30)21-16-9-13(6-7-17(16)26-28-21)15-5-4-8-25-23(15)24/h4-12H,1-3H3,(H,26,28) |
| InChIKey | GRLVKFBNEXJRDE-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 99.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.44 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|