C19H16BrFN6O — CID 170649133
5-bromo-6-fluoro-1-(oxan-2-yl)-3-(1-pyridin-4-yltriazol-4-yl)indazole (PubChem CID 170649133) has the molecular formula C19H16BrFN6O and a molecular weight of 443.28 g/mol. Its IUPAC name is 5-bromo-6-fluoro-1-(oxan-2-yl)-3-(1-pyridin-4-yltriazol-4-yl)indazole.
| Compound Name | 5-bromo-6-fluoro-1-(oxan-2-yl)-3-(1-pyridin-4-yltriazol-4-yl)indazole |
|---|---|
| PubChem CID | 170649133 |
| Molecular Formula | C19H16BrFN6O |
| Molecular Weight | 443.28 g/mol |
| Exact Mass | 442.06 |
| IUPAC Name | 5-bromo-6-fluoro-1-(oxan-2-yl)-3-(1-pyridin-4-yltriazol-4-yl)indazole |
| SMILES | Fc1cc2c(cc1Br)c(-c1cn(-c3ccncc3)nn1)nn2C1CCCCO1 |
| InChI | InChI=1S/C19H16BrFN6O/c20-14-9-13-17(10-15(14)21)27(18-3-1-2-8-28-18)24-19(13)16-11-26(25-23-16)12-4-6-22-7-5-12/h4-7,9-11,18H,1-3,8H2 |
| InChIKey | OVAQPZHLMVMNCR-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 70.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.28 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |