C30H28F2N4O3 — CID 170649525
3-[6-[3-fluoro-4-[(4-fluoro-4-phenylpiperidin-1-yl)methyl]-2-pyridinyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 170649525) has the molecular formula C30H28F2N4O3 and a molecular weight of 530.58 g/mol. Its IUPAC name is 3-[6-[3-fluoro-4-[(4-fluoro-4-phenylpiperidin-1-yl)methyl]-2-pyridinyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[3-fluoro-4-[(4-fluoro-4-phenylpiperidin-1-yl)methyl]-2-pyridinyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 170649525 |
| Molecular Formula | C30H28F2N4O3 |
| Molecular Weight | 530.58 g/mol |
| Exact Mass | 530.21 |
| IUPAC Name | 3-[6-[3-fluoro-4-[(4-fluoro-4-phenylpiperidin-1-yl)methyl]-2-pyridinyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(-c4nccc(CN5CCC(F)(c6ccccc6)CC5)c4F)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C30H28F2N4O3/c31-26-20(17-35-14-11-30(32,12-15-35)22-4-2-1-3-5-22)10-13-33-27(26)19-6-7-23-21(16-19)18-36(29(23)39)24-8-9-25(37)34-28(24)38/h1-7,10,13,16,24H,8-9,11-12,14-15,17-18H2,(H,34,37,38) |
| InChIKey | CHDGVUUMDYFZGW-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.58 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|