C25H26F2N4O3 — CID 165403445
3-[6-[3-fluoro-4-[(4-fluoro-4-methylpiperidin-1-yl)methyl]-2-pyridinyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 165403445) has the molecular formula C25H26F2N4O3 and a molecular weight of 468.50 g/mol. Its IUPAC name is 3-[6-[3-fluoro-4-[(4-fluoro-4-methylpiperidin-1-yl)methyl]-2-pyridinyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[3-fluoro-4-[(4-fluoro-4-methylpiperidin-1-yl)methyl]-2-pyridinyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 165403445 |
| Molecular Formula | C25H26F2N4O3 |
| Molecular Weight | 468.50 g/mol |
| Exact Mass | 468.20 |
| IUPAC Name | 3-[6-[3-fluoro-4-[(4-fluoro-4-methylpiperidin-1-yl)methyl]-2-pyridinyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CC1(F)CCN(Cc2ccnc(-c3ccc4c(c3)CN(C3CCC(=O)NC3=O)C4=O)c2F)CC1 |
| InChI | InChI=1S/C25H26F2N4O3/c1-25(27)7-10-30(11-8-25)13-16-6-9-28-22(21(16)26)15-2-3-18-17(12-15)14-31(24(18)34)19-4-5-20(32)29-23(19)33/h2-3,6,9,12,19H,4-5,7-8,10-11,13-14H2,1H3,(H,29,32,33) |
| InChIKey | DOPGHCQYRFOTMW-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.50 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|