C28H30FN5O5 — CID 170649458
methyl 1-[[2-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-3-fluoro-4-pyridinyl]methyl]-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine-6-carboxylate (PubChem CID 170649458) has the molecular formula C28H30FN5O5 and a molecular weight of 535.58 g/mol. Its IUPAC name is methyl 1-[[2-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-3-fluoro-4-pyridinyl]methyl]-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine-6-carboxylate.
| Compound Name | methyl 1-[[2-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-3-fluoro-4-pyridinyl]methyl]-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine-6-carboxylate |
|---|---|
| PubChem CID | 170649458 |
| Molecular Formula | C28H30FN5O5 |
| Molecular Weight | 535.58 g/mol |
| Exact Mass | 535.22 |
| IUPAC Name | methyl 1-[[2-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-3-fluoro-4-pyridinyl]methyl]-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine-6-carboxylate |
| SMILES | COC(=O)N1CC2CCCN(Cc3ccnc(-c4ccc5c(c4)CN(C4CCC(=O)NC4=O)C5=O)c3F)C2C1 |
| InChI | InChI=1S/C28H30FN5O5/c1-39-28(38)33-12-17-3-2-10-32(22(17)15-33)13-18-8-9-30-25(24(18)29)16-4-5-20-19(11-16)14-34(27(20)37)21-6-7-23(35)31-26(21)36/h4-5,8-9,11,17,21-22H,2-3,6-7,10,12-15H2,1H3,(H,31,35,36) |
| InChIKey | NOXDHHDXLZPFHY-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.58 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|