C26H19F4N3O — CID 170653066
4-(4-ethynylphenyl)-1-(3-fluorophenyl)-N-[[3-methoxy-4-(trifluoromethyl)phenyl]methyl]imidazol-2-amine (PubChem CID 170653066) has the molecular formula C26H19F4N3O and a molecular weight of 465.45 g/mol. Its IUPAC name is 4-(4-ethynylphenyl)-1-(3-fluorophenyl)-N-[[3-methoxy-4-(trifluoromethyl)phenyl]methyl]imidazol-2-amine.
| Compound Name | 4-(4-ethynylphenyl)-1-(3-fluorophenyl)-N-[[3-methoxy-4-(trifluoromethyl)phenyl]methyl]imidazol-2-amine |
|---|---|
| PubChem CID | 170653066 |
| Molecular Formula | C26H19F4N3O |
| Molecular Weight | 465.45 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | 4-(4-ethynylphenyl)-1-(3-fluorophenyl)-N-[[3-methoxy-4-(trifluoromethyl)phenyl]methyl]imidazol-2-amine |
| SMILES | C#Cc1ccc(-c2cn(-c3cccc(F)c3)c(NCc3ccc(C(F)(F)F)c(OC)c3)n2)cc1 |
| InChI | InChI=1S/C26H19F4N3O/c1-3-17-7-10-19(11-8-17)23-16-33(21-6-4-5-20(27)14-21)25(32-23)31-15-18-9-12-22(26(28,29)30)24(13-18)34-2/h1,4-14,16H,15H2,2H3,(H,31,32) |
| InChIKey | FYNKATHJYXXWCE-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.45 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|