C55H52N6Pt-2 — CID 170654692
CID 170654692 (PubChem CID 170654692) has the molecular formula C55H52N6Pt-2 and a molecular weight of 992.14 g/mol.
| Compound Name | CID 170654692 |
|---|---|
| PubChem CID | 170654692 |
| Molecular Formula | C55H52N6Pt-2 |
| Molecular Weight | 992.14 g/mol |
| Exact Mass | 991.39 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1cc(-[n+]2[c-]n(-c3[c-]c(N(c4[c-]c5c(cc4)c4ccccc4n5-c4cc(C(C)(C)C)ccn4)c4ccccc4)ccc3)nc2-c2ccccc2)cc(C(C)(C)C)c1.[Pt] |
| InChI | InChI=1S/C55H52N6.Pt/c1-53(2,3)39-29-30-56-51(34-39)61-49-26-17-16-25-47(49)48-28-27-45(36-50(48)61)60(42-21-14-11-15-22-42)44-24-18-23-43(35-44)59-37-58(52(57-59)38-19-12-10-13-20-38)46-32-40(54(4,5)6)31-41(33-46)55(7,8)9;/h10-34H,1-9H3;/q-2; |
| InChIKey | AXSJXLMQYIPLEJ-UHFFFAOYSA-N |
| XLogP | 13.07 |
| TPSA | 42.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 992.14 |
| LogP ≤ 5 | 13.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|