C31H31NO2 — CID 170658776
4,21-bis(2,2-dimethylpropyl)-19,23-dioxa-12-azahexacyclo[11.10.1.03,8.09,24.014,22.016,20]tetracosa-1,3,5,7,9(24),10,12,14(22),15,17,20-undecaene (PubChem CID 170658776) has the molecular formula C31H31NO2 and a molecular weight of 449.59 g/mol. Its IUPAC name is 4,21-bis(2,2-dimethylpropyl)-19,23-dioxa-12-azahexacyclo[11.10.1.03,8.09,24.014,22.016,20]tetracosa-1,3,5,7,9(24),10,12,14(22),15,17,20-undecaene.
| Compound Name | 4,21-bis(2,2-dimethylpropyl)-19,23-dioxa-12-azahexacyclo[11.10.1.03,8.09,24.014,22.016,20]tetracosa-1,3,5,7,9(24),10,12,14(22),15,17,20-undecaene |
|---|---|
| PubChem CID | 170658776 |
| Molecular Formula | C31H31NO2 |
| Molecular Weight | 449.59 g/mol |
| Exact Mass | 449.24 |
| IUPAC Name | 4,21-bis(2,2-dimethylpropyl)-19,23-dioxa-12-azahexacyclo[11.10.1.03,8.09,24.014,22.016,20]tetracosa-1,3,5,7,9(24),10,12,14(22),15,17,20-undecaene |
| SMILES | CC(C)(C)Cc1cccc2c1cc1c3c(nccc32)-c2cc3ccoc3c(CC(C)(C)C)c2O1 |
| InChI | InChI=1S/C31H31NO2/c1-30(2,3)16-19-8-7-9-20-21-10-12-32-27-23-14-18-11-13-33-28(18)24(17-31(4,5)6)29(23)34-25(26(21)27)15-22(19)20/h7-15H,16-17H2,1-6H3 |
| InChIKey | MTMJDBLICDQDHC-UHFFFAOYSA-N |
| XLogP | 9.08 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.59 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|