C35H37N — CID 170658449
23-deuterio-10,16-bis(2,2-dimethylpropyl)-6-methyl-24-azahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-1(24),2(11),3,5,7,9,13,15,17,19,21(25),22-dodecaene (PubChem CID 170658449) has the molecular formula C35H37N and a molecular weight of 472.69 g/mol. Its IUPAC name is 23-deuterio-10,16-bis(2,2-dimethylpropyl)-6-methyl-24-azahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-1(24),2(11),3,5,7,9,13,15,17,19,21(25),22-dodecaene.
| Compound Name | 23-deuterio-10,16-bis(2,2-dimethylpropyl)-6-methyl-24-azahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-1(24),2(11),3,5,7,9,13,15,17,19,21(25),22-dodecaene |
|---|---|
| PubChem CID | 170658449 |
| Molecular Formula | C35H37N |
| Molecular Weight | 472.69 g/mol |
| Exact Mass | 472.30 |
| IUPAC Name | 23-deuterio-10,16-bis(2,2-dimethylpropyl)-6-methyl-24-azahexacyclo[11.11.1.02,11.04,9.015,20.021,25]pentacosa-1(24),2(11),3,5,7,9,13,15,17,19,21(25),22-dodecaene |
| SMILES | [2H]c1cc2c3c(cc4c(CC(C)(C)C)cccc42)Cc2c(cc4cc(C)ccc4c2CC(C)(C)C)-c3n1 |
| InChI | InChI=1S/C35H37N/c1-21-11-12-25-23(15-21)16-30-29(31(25)20-35(5,6)7)18-24-17-28-22(19-34(2,3)4)9-8-10-26(28)27-13-14-36-33(30)32(24)27/h8-17H,18-20H2,1-7H3/i14D |
| InChIKey | CGVKDEWOFCPJJF-FCFVPJCTSA-N |
| XLogP | 9.60 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.69 |
| LogP ≤ 5 | 9.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|