C34H35NS — CID 170658969
10,17-bis(2,2-dimethylpropyl)-6-methyl-12-thia-24-azahexacyclo[11.11.1.02,11.04,9.014,19.021,25]pentacosa-1(24),2(11),3,5,7,9,13(25),14(19),15,17,20,22-dodecaene (PubChem CID 170658969) has the molecular formula C34H35NS and a molecular weight of 489.73 g/mol. Its IUPAC name is 10,17-bis(2,2-dimethylpropyl)-6-methyl-12-thia-24-azahexacyclo[11.11.1.02,11.04,9.014,19.021,25]pentacosa-1(24),2(11),3,5,7,9,13(25),14(19),15,17,20,22-dodecaene.
| Compound Name | 10,17-bis(2,2-dimethylpropyl)-6-methyl-12-thia-24-azahexacyclo[11.11.1.02,11.04,9.014,19.021,25]pentacosa-1(24),2(11),3,5,7,9,13(25),14(19),15,17,20,22-dodecaene |
|---|---|
| PubChem CID | 170658969 |
| Molecular Formula | C34H35NS |
| Molecular Weight | 489.73 g/mol |
| Exact Mass | 489.25 |
| IUPAC Name | 10,17-bis(2,2-dimethylpropyl)-6-methyl-12-thia-24-azahexacyclo[11.11.1.02,11.04,9.014,19.021,25]pentacosa-1(24),2(11),3,5,7,9,13(25),14(19),15,17,20,22-dodecaene |
| SMILES | Cc1ccc2c(CC(C)(C)C)c3c(cc2c1)-c1nccc2cc4cc(CC(C)(C)C)ccc4c(c12)S3 |
| InChI | InChI=1S/C34H35NS/c1-20-8-10-25-23(14-20)17-27-30-29-22(12-13-35-30)16-24-15-21(18-33(2,3)4)9-11-26(24)32(29)36-31(27)28(25)19-34(5,6)7/h8-17H,18-19H2,1-7H3 |
| InChIKey | ZMBUJCXNWRZDEZ-UHFFFAOYSA-N |
| XLogP | 10.16 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.73 |
| LogP ≤ 5 | 10.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|