About CID 170659221
CID 170659221 (PubChem CID 170659221) has the molecular formula C45H60IrNO2S-
and a molecular weight of 876.29 g/mol.
Molecular Properties
| Compound Name | CID 170659221 |
| PubChem CID | 170659221 |
| Molecular Formula | C45H60IrNO2S- |
| Molecular Weight | 876.29 g/mol |
| Exact Mass | 876.43 |
| IUPAC Name | — |
| SMILES | CCC(C)(CC)C(=O)/C=C(\O)C(C)(CC)CC.[2H]c1nc2c3c(cc(CC(C)(C)C)cc3c1[2H])Sc1c-2[c-]c2cc(C([2H])([2H])[2H])ccc2c1CC(C)(C)C.[Ir] |
| InChI | InChI=1S/C30H32NS.C15H28O2.Ir/c1-18-8-9-22-21(12-18)15-23-27-26-20(10-11-31-27)13-19(16-29(2,3)4)14-25(26)32-28(23)24(22)17-30(5,6)7;1-7-14(5,8-2)12(16)11-13(17)15(6,9-3)10-4;/h8-14H,16-17H2,1-7H3;11,16H,7-10H2,1-6H3;/q-1;;/b;12-11-;/i1D3,10D,11D;; |
| InChIKey | TVQVXUMOSHOOHC-AHORJLKISA-N |
| XLogP | 13.45 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 876.29 |
| LogP ≤ 5 | 13.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze CID 170659221 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 170659221?
The IUPAC name of CID 170659221 (CID 170659221) is not available.
What is the SMILES notation for CID 170659221?
The canonical SMILES for CID 170659221 is CCC(C)(CC)C(=O)/C=C(\O)C(C)(CC)CC.[2H]c1nc2c3c(cc(CC(C)(C)C)cc3c1[2H])Sc1c-2[c-]c2cc(C([2H])([2H])[2H])ccc2c1CC(C)(C)C.[Ir].
What is the InChIKey of CID 170659221?
The InChIKey is TVQVXUMOSHOOHC-AHORJLKISA-N. The full InChI is InChI=1S/C30H32NS.C15H28O2.Ir/c1-18-8-9-22-21(12-18)15-23-27-26-20(10-11-31-27)13-19(16-29(2,3)4)14-25(26)32-28(23)24(22)17-30(5,6)7;1-7-14(5,8-2)12(16)11-13(17)15(6,9-3)10-4;/h8-14H,16-17H2,1-7H3;11,16H,7-10H2,1-6H3;/q-1;;/b;12-11-;/i1D3,10D,11D;;.
What are the key properties of CID 170659221?
CID 170659221 has a molecular weight of 876.29 g/mol, XLogP of 13.45, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 170659221 is sourced from PubChem (CID 170659221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).