C46H56IrNO2S- — CID 170659204
CID 170659204 (PubChem CID 170659204) has the molecular formula C46H56IrNO2S- and a molecular weight of 879.24 g/mol.
| Compound Name | CID 170659204 |
|---|---|
| PubChem CID | 170659204 |
| Molecular Formula | C46H56IrNO2S- |
| Molecular Weight | 879.24 g/mol |
| Exact Mass | 879.37 |
| IUPAC Name | — |
| SMILES | CC(C)Cc1c2c([c-]c3ccccc13)-c1nccc3c1c(cc1c(CC(C)(C)C)cccc13)S2.CCC(CC)C(=O)/C=C(\O)C(C)(CC)CC.[Ir] |
| InChI | InChI=1S/C32H30NS.C14H26O2.Ir/c1-19(2)15-26-22-11-7-6-9-20(22)16-27-30-29-24(13-14-33-30)23-12-8-10-21(18-32(3,4)5)25(23)17-28(29)34-31(26)27;1-6-11(7-2)12(15)10-13(16)14(5,8-3)9-4;/h6-14,17,19H,15,18H2,1-5H3;10-11,16H,6-9H2,1-5H3;/q-1;;/b;13-10-; |
| InChIKey | XLSVTWYMMBLMIC-BEGQHWPVSA-N |
| XLogP | 13.52 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 879.24 |
| LogP ≤ 5 | 13.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|