C46H54GeIrNO3- — CID 170932078
(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;dimethyl-[3-[8-(2-methylpropyl)-[1]benzofuro[2,3-c]pyridin-1-yl]-4H-naphthalen-4-id-1-yl]-phenylgermane;iridium (PubChem CID 170932078) has the molecular formula C46H54GeIrNO3- and a molecular weight of 933.77 g/mol. Its IUPAC name is (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;dimethyl-[3-[8-(2-methylpropyl)-[1]benzofuro[2,3-c]pyridin-1-yl]-4H-naphthalen-4-id-1-yl]-phenylgermane;iridium.
| Compound Name | (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;dimethyl-[3-[8-(2-methylpropyl)-[1]benzofuro[2,3-c]pyridin-1-yl]-4H-naphthalen-4-id-1-yl]-phenylgermane;iridium |
|---|---|
| PubChem CID | 170932078 |
| Molecular Formula | C46H54GeIrNO3- |
| Molecular Weight | 933.77 g/mol |
| Exact Mass | 935.30 |
| IUPAC Name | (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;dimethyl-[3-[8-(2-methylpropyl)-[1]benzofuro[2,3-c]pyridin-1-yl]-4H-naphthalen-4-id-1-yl]-phenylgermane;iridium |
| SMILES | CC(C)Cc1cccc2c1oc1c(-c3[c-]c4ccccc4c([Ge](C)(C)c4ccccc4)c3)nccc12.CCC(CC)C(=O)/C=C(\O)C(CC)CC.[Ir] |
| InChI | InChI=1S/C33H30GeNO.C13H24O2.Ir/c1-22(2)19-24-12-10-16-28-29-17-18-35-31(33(29)36-32(24)28)25-20-23-11-8-9-15-27(23)30(21-25)34(3,4)26-13-6-5-7-14-26;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h5-18,21-22H,19H2,1-4H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-; |
| InChIKey | MVGXFZLQMAJMAT-DZTQYQPZSA-N |
| XLogP | 11.49 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 933.77 |
| LogP ≤ 5 | 11.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|