C14H11FN4 — CID 170661137
N-[(E)-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)methylideneamino]aniline (PubChem CID 170661137) has the molecular formula C14H11FN4 and a molecular weight of 254.27 g/mol. Its IUPAC name is N-[(E)-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)methylideneamino]aniline.
| Compound Name | N-[(E)-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)methylideneamino]aniline |
|---|---|
| PubChem CID | 170661137 |
| Molecular Formula | C14H11FN4 |
| Molecular Weight | 254.27 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | N-[(E)-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)methylideneamino]aniline |
| SMILES | Fc1cnc2[nH]cc(/C=N/Nc3ccccc3)c2c1 |
| InChI | InChI=1S/C14H11FN4/c15-11-6-13-10(7-16-14(13)17-9-11)8-18-19-12-4-2-1-3-5-12/h1-9,19H,(H,16,17)/b18-8+ |
| InChIKey | DFJZQGWYKQBQTQ-QGMBQPNBSA-N |
| XLogP | 3.15 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.27 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|