C30H32F3N3O5 — CID 170666455
2-(3-benzoyl-5,5,5-trifluoropentyl)-3-ethyl-8-(methoxymethyl)-5-phenylmethoxy-1,2-dihydropyrido[2,1-f][1,2,4]triazine-4,6-dione (PubChem CID 170666455) has the molecular formula C30H32F3N3O5 and a molecular weight of 571.60 g/mol. Its IUPAC name is 2-(3-benzoyl-5,5,5-trifluoropentyl)-3-ethyl-8-(methoxymethyl)-5-phenylmethoxy-1,2-dihydropyrido[2,1-f][1,2,4]triazine-4,6-dione.
| Compound Name | 2-(3-benzoyl-5,5,5-trifluoropentyl)-3-ethyl-8-(methoxymethyl)-5-phenylmethoxy-1,2-dihydropyrido[2,1-f][1,2,4]triazine-4,6-dione |
|---|---|
| PubChem CID | 170666455 |
| Molecular Formula | C30H32F3N3O5 |
| Molecular Weight | 571.60 g/mol |
| Exact Mass | 571.23 |
| IUPAC Name | 2-(3-benzoyl-5,5,5-trifluoropentyl)-3-ethyl-8-(methoxymethyl)-5-phenylmethoxy-1,2-dihydropyrido[2,1-f][1,2,4]triazine-4,6-dione |
| SMILES | CCN1C(=O)c2c(OCc3ccccc3)c(=O)cc(COC)n2NC1CCC(CC(F)(F)F)C(=O)c1ccccc1 |
| InChI | InChI=1S/C30H32F3N3O5/c1-3-35-25(15-14-22(17-30(31,32)33)27(38)21-12-8-5-9-13-21)34-36-23(19-40-2)16-24(37)28(26(36)29(35)39)41-18-20-10-6-4-7-11-20/h4-13,16,22,25,34H,3,14-15,17-19H2,1-2H3 |
| InChIKey | YICPNFLBRWADGK-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.60 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |