C19H18N6O3 — CID 170666555
(3S,6S,7S)-6-azido-11-methoxy-8-methyl-3-phenyl-1,2,8-triazatricyclo[8.4.0.02,7]tetradeca-4,10,13-triene-9,12-dione (PubChem CID 170666555) has the molecular formula C19H18N6O3 and a molecular weight of 378.39 g/mol. Its IUPAC name is (3S,6S,7S)-6-azido-11-methoxy-8-methyl-3-phenyl-1,2,8-triazatricyclo[8.4.0.02,7]tetradeca-4,10,13-triene-9,12-dione.
| Compound Name | (3S,6S,7S)-6-azido-11-methoxy-8-methyl-3-phenyl-1,2,8-triazatricyclo[8.4.0.02,7]tetradeca-4,10,13-triene-9,12-dione |
|---|---|
| PubChem CID | 170666555 |
| Molecular Formula | C19H18N6O3 |
| Molecular Weight | 378.39 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | (3S,6S,7S)-6-azido-11-methoxy-8-methyl-3-phenyl-1,2,8-triazatricyclo[8.4.0.02,7]tetradeca-4,10,13-triene-9,12-dione |
| SMILES | COc1c2n(ccc1=O)N1[C@H](c3ccccc3)C=C[C@H](N=[N+]=[N-])[C@H]1N(C)C2=O |
| InChI | InChI=1S/C19H18N6O3/c1-23-18-13(21-22-20)8-9-14(12-6-4-3-5-7-12)25(18)24-11-10-15(26)17(28-2)16(24)19(23)27/h3-11,13-14,18H,1-2H3/t13-,14-,18-/m0/s1 |
| InChIKey | WGCJTQJBWQUCHJ-DEYYWGMASA-N |
| XLogP | 2.20 |
| TPSA | 103.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.39 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|