C19H24N4O6S2 — CID 17066698
N-(4-morpholin-4-ylsulfonylphenyl)-2-[(4-sulfamoylphenyl)methylamino]acetamide (PubChem CID 17066698) has the molecular formula C19H24N4O6S2 and a molecular weight of 468.56 g/mol. Its IUPAC name is N-(4-morpholin-4-ylsulfonylphenyl)-2-[(4-sulfamoylphenyl)methylamino]acetamide.
| Compound Name | N-(4-morpholin-4-ylsulfonylphenyl)-2-[(4-sulfamoylphenyl)methylamino]acetamide |
|---|---|
| PubChem CID | 17066698 |
| Molecular Formula | C19H24N4O6S2 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | N-(4-morpholin-4-ylsulfonylphenyl)-2-[(4-sulfamoylphenyl)methylamino]acetamide |
| SMILES | NS(=O)(=O)c1ccc(CNCC(=O)Nc2ccc(S(=O)(=O)N3CCOCC3)cc2)cc1 |
| InChI | InChI=1S/C19H24N4O6S2/c20-30(25,26)17-5-1-15(2-6-17)13-21-14-19(24)22-16-3-7-18(8-4-16)31(27,28)23-9-11-29-12-10-23/h1-8,21H,9-14H2,(H,22,24)(H2,20,25,26) |
| InChIKey | HQBGVLDVVMHDJB-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 147.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |