C15H16N4O4 — CID 17066743
N-(2-methoxy-4-nitrophenyl)-2-(pyridin-4-ylmethylamino)acetamide (PubChem CID 17066743) has the molecular formula C15H16N4O4 and a molecular weight of 316.32 g/mol. Its IUPAC name is N-(2-methoxy-4-nitrophenyl)-2-(pyridin-4-ylmethylamino)acetamide.
| Compound Name | N-(2-methoxy-4-nitrophenyl)-2-(pyridin-4-ylmethylamino)acetamide |
|---|---|
| PubChem CID | 17066743 |
| Molecular Formula | C15H16N4O4 |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | N-(2-methoxy-4-nitrophenyl)-2-(pyridin-4-ylmethylamino)acetamide |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=O)CNCc1ccncc1 |
| InChI | InChI=1S/C15H16N4O4/c1-23-14-8-12(19(21)22)2-3-13(14)18-15(20)10-17-9-11-4-6-16-7-5-11/h2-8,17H,9-10H2,1H3,(H,18,20) |
| InChIKey | SFKJHBUIQORUIO-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 106.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|