C22H24N6O4S — CID 170667494
5-(2,6-dimethylphenyl)-9,9-dioxo-2-oxa-9λ6-thia-6,8,12,13,16,22-hexazatetracyclo[14.3.1.13,7.110,13]docosa-3(22),4,6,10(21),11-pentaen-15-one (PubChem CID 170667494) has the molecular formula C22H24N6O4S and a molecular weight of 468.54 g/mol. Its IUPAC name is 5-(2,6-dimethylphenyl)-9,9-dioxo-2-oxa-9λ6-thia-6,8,12,13,16,22-hexazatetracyclo[14.3.1.13,7.110,13]docosa-3(22),4,6,10(21),11-pentaen-15-one.
| Compound Name | 5-(2,6-dimethylphenyl)-9,9-dioxo-2-oxa-9λ6-thia-6,8,12,13,16,22-hexazatetracyclo[14.3.1.13,7.110,13]docosa-3(22),4,6,10(21),11-pentaen-15-one |
|---|---|
| PubChem CID | 170667494 |
| Molecular Formula | C22H24N6O4S |
| Molecular Weight | 468.54 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | 5-(2,6-dimethylphenyl)-9,9-dioxo-2-oxa-9λ6-thia-6,8,12,13,16,22-hexazatetracyclo[14.3.1.13,7.110,13]docosa-3(22),4,6,10(21),11-pentaen-15-one |
| SMILES | Cc1cccc(C)c1-c1cc2nc(n1)NS(=O)(=O)c1cnn(c1)CC(=O)N1CCCC(C1)O2 |
| InChI | InChI=1S/C22H24N6O4S/c1-14-5-3-6-15(2)21(14)18-9-19-25-22(24-18)26-33(30,31)17-10-23-28(12-17)13-20(29)27-8-4-7-16(11-27)32-19/h3,5-6,9-10,12,16H,4,7-8,11,13H2,1-2H3,(H,24,25,26) |
| InChIKey | JEIJFDKHBKXREO-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 119.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.54 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |